Is acetylacetone a strong acid?
Rachel Hernandez
Updated on March 22, 2026
Very strong bases, such as organolithium compounds, will deprotonate acetylacetone twice.
Acid–base properties.
| solvent | T/°C | pKa |
|---|---|---|
| DMSO | 25 | 13.41 |
Subsequently, one may also ask, which is more acidic acetone or acetylacetone?
Why acetylacetone (acac, or pentane-2,4-dione) is more acidic than acetone (propan-2-one). Protonation of the conjugate base of acac leads to a molecule containing —OH and alkene groups.
One may also ask, how many acidic protons are in acetylacetone? Acetylacetone (3) has a pKa of around 9 , so that's a good possibility right now. From there, you would have to consider what makes it even more (or less) acidic: an acetyl group ( H3C(C=O)− ) or an acetoxy group ( H3C−O−(C=O)− ).
Also, is acac a base?
Structure and bonding
In the majority of its complexes acac forms six-membered C3O2M chelate rings. In terms of electron counting, neutral bidentate O,O-bonded acac ligand is an "L-X ligand", i.e. a combination of a Lewis base (L) and a pseudohalide (X).
What type of molecule is acetylacetone?
A β-diketone that is pentane in which the hydrogens at positions 2 and 4 are replaced by oxo groups. Acetylacetone is an organic compound with the chemical formula CH3COCH2COCH3. It is a colorless liquid, classified as a 1,3-diketone. It exists in equilibrium with a tautomer CH3C(O)CH=(OH)CH3.
Related Question Answers
What is the structure of acetylacetone?
C5H8O2
Which ketone is the most acidic?
Ketones (pKa ~ 20) are more acidic than esters (pKa ~ 25). The figure below shows the resonance structures for the enolate anion of a ketone and an ester. Resonance structures II and IV stabilize the enolate anion in the ketone and ester respectively. In the ester, there is an additional resonance structure, V.What is the pKa of acetylacetone?
ABSTRACT The dissociation constant pKa of acetylacetone has been determined potentiometrically. The pKa value obtained is 9.40, indicating a weak acid.Which are stronger acids alcohols and thiols?
A thiol is more acidic than an alcohol. Note that S and O are in the same group of the periodic table. The thiol is more acidic because the sulfur atom is larger than the oxygen atom.Which is more acidic acetone or diethyl malonate?
IIT JAM Question. The most acidic hydrogen in either of the two carbonyl compounds is the a-hydrogen of diethyl malonate; thus, formation of the conjugate-base anion of diethyl malonate consumes the sodium ethoxide. Formation of the conjugate-base enolate ion of acetone therefore will not be a competing reaction.Which of the following has the least acidic hydrogen Labelled in red?
Hence, we conclude that the hydrogen in Option (3) is the least acidic.Is acetylacetone a strong field ligand?
An easy way to identify this: The ligands in which the donor atom is Nitrogen and carbon is a strong field ligand and the ligand in which the donor atom is a halogen or oxygen is a weak field ligand. So in acac the donating atoms are Oxygen making it a weak field whereas in NH3 the donating is N making it strong field.What is acetylacetone used for?
Acetylacetone is used in the production of anti-corrosion agents and its peroxide compounds for the radical initiator application for polymerisation. It is used as a chemical intermediate for drugs (such as sulphamethazine, nicarbazine, vitamin B6, and vitamin K) and pesticides sulfonylurea herbicides and pesticides.Is acac a neutral ligand?
Acetylacetonate (acac-, top) is an anionic bidentate ligand that coordinates metal ions through two oxygen atoms. With divalent metal ions, acac-forms neutral, volatile complexes such as Cu(acac)2 and Mo(acac)2 that are useful for chemical vapor deposition (CVD) of metal thin films.What is the density of acetylacetone?
980 kg/m³
Why is enol form of acetylacetone more stable?
There are some compounds wherein the enol form can be high because of its greater stability as in the case of acetylacetone. The enol form has greater stability than expected because of intramolecular hydrogen bonding to a 6 membered cyclic transition state.Is ACAC polar or nonpolar?
acac is a non-polar ligand.Is acac a pi acceptor?
We have investigated the role of both the donor and acceptor functions containing the boptz2- bridging ligand in combination with the electronically different ancillary ligands (donating acac-, moderately pi-accepting bpy, and strongly pi-accepting pap; acac = acetylacetonate, bpy = 2,2'-bipyridine pap = 2-Why is acac 3 diamagnetic?
The 1H-NMR spectrum of Co(acac)3 (Figure 4) has sharp resonances much like the aluminium complex. From this it can be determined that the complex is diamagnetic. The low spin complex has no unpaired electrons which is diamagnetic, thus the cobalt complex adopts a low spin configuration.What is acac?
Acetylacetonate (acac), a ligand in coordination chemistry derived from acetylacetone.What is the Iupac name of acetylacetone?
| IUPAC Name | pentane-2,4-dione |
|---|---|
| Alternative Names | 2,4-Pentanedione Acetylacetone Pentane-2,4-dione Acetoacetone Diacetylmethane 2,4-Dioxopentane |
| Molecular Formula | C5H8O2 |
| Molar Mass | 100.117 g/mol |
| InChI | InChI=1S/C5H8O2/c1-4(6)3-5(2)7/h3H2,1-2H3 |
What is the normal boiling point of acetylacetone?
284°F (140°C)
Why is acac Bidentate?
Acetylacetonate ion contains two O atoms which allow this ligand to function as a bidentate ligand.In which of the following compounds hydrogen shown is most acidic?
CH2-O∣∣C-CH2-O∣∣C-CH2-CH3,(-CH2-) group is flanked on both sides by electron-withdrawing groups and hence its hydrogen are most acidic.What is the charge of acac?
When deprotanated, each ligand carries a negative one charge and the 5 membered O-C-C-C-O ring is planar. The ligand is called acetonylacetonate and is abbreviated "acac".What is the molar mass of 2 4 pentanedione?
100.13 g/mol
What is the molecular weight of acetylacetone?
100.13 g/mol
